* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-ACETYL-3,4-DIHYDRO-2H-1,4-BENZOXAZIN-3-ONE |
| English Synonyms: | 8-ACETYL-3,4-DIHYDRO-2H-1,4-BENZOXAZIN-3-ONE |
| MDL Number.: | MFCD12196332 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC(=O)c1cccc2c1OCC(=O)N2 |
| InChi: | InChI=1S/C10H9NO3/c1-6(12)7-3-2-4-8-10(7)14-5-9(13)11-8/h2-4H,5H2,1H3,(H,11,13) |
| InChiKey: | InChIKey=DCNCUMXYUOEPOJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.