Molecular Structure:
CCD No.:CCD08257002
ZERENEX E/8011334
Formula:C20 H15 N O4
MolWeight:333.341
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/8011334 |
| English Synonyms： | ZERENEX E/8011334 |
| MDL Number.： | MFCD13876685 |
| H bond acceptor： | 5 |
| H bond donor： | 3 |
| Smile： | c1ccc(cc1)c2ccc(cc2)C(=O)Nc3ccc(c(c3)O)C(=O)O |
| InChi： | InChI=1S/C20H15NO4/c22-18-12-16(10-11-17(18)20(24)25)21-19(23)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-12,22H,(H,21,23)(H,24,25) |
| InChiKey： | InChIKey=UETPYDLKNBRFNH-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
