Molecular Structure:
CCD No.:CCD08257476
ZERENEX E/8011945
Formula:C18 H11 Cl2 N O4
MolWeight:376.194
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/8011945 |
| English Synonyms： | ZERENEX E/8011945 |
| MDL Number.： | MFCD13877159 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | c1cc(cc(c1)NC(=O)c2ccc(o2)c3cccc(c3Cl)Cl)C(=O)O |
| InChi： | InChI=1S/C18H11Cl2NO4/c19-13-6-2-5-12(16(13)20)14-7-8-15(25-14)17(22)21-11-4-1-3-10(9-11)18(23)24/h1-9H,(H,21,22)(H,23,24) |
| InChiKey： | InChIKey=TUWMDZOWTABHKA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
