Molecular Structure:
CCD No.:CCD08257937
ZERENEX E/8012536
Formula:C20 H18 Br N O5
MolWeight:432.268
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/8012536 |
| English Synonyms： | ZERENEX E/8012536 |
| MDL Number.： | MFCD13877620 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | COc1ccc(cc1C(=O)Nc2cc(ccc2OC)c3ccc(o3)CO)Br |
| InChi： | InChI=1S/C20H18BrNO5/c1-25-18-7-4-13(21)10-15(18)20(24)22-16-9-12(3-6-19(16)26-2)17-8-5-14(11-23)27-17/h3-10,23H,11H2,1-2H3,(H,22,24) |
| InChiKey： | InChIKey=HNEVGLHZBXXOLD-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
