Molecular Structure:
CCD No.:CCD08258646
ZERENEX E/8013350
Formula:C14 H7 Br2 Cl I N O3
MolWeight:559.374
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/8013350 |
| English Synonyms： | ZERENEX E/8013350 |
| MDL Number.： | MFCD13878329 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | c1cc(c(cc1C(=O)O)NC(=O)c2cc(cc(c2I)Br)Br)Cl |
| InChi： | InChI=1S/C14H7Br2ClINO3/c15-7-4-8(12(18)9(16)5-7)13(20)19-11-3-6(14(21)22)1-2-10(11)17/h1-5H,(H,19,20)(H,21,22) |
| InChiKey： | InChIKey=PRUJSAVKDGDDIX-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
