Molecular Structure:
CCD No.:CCD08258863
ZERENEX E/8013628
Formula:C18 H15 Br N2 O4
MolWeight:403.23
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/8013628 |
| English Synonyms： | ZERENEX E/8013628 |
| MDL Number.： | MFCD13878546 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | COc1ccc(cc1NC(=O)c2cc(cnc2)Br)c3ccc(o3)CO |
| InChi： | InChI=1S/C18H15BrN2O4/c1-24-17-4-2-11(16-5-3-14(10-22)25-16)7-15(17)21-18(23)12-6-13(19)9-20-8-12/h2-9,22H,10H2,1H3,(H,21,23) |
| InChiKey： | InChIKey=QKRSTNCTOHTVFC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
