Molecular Structure:
CCD No.:CCD08259348
ZERENEX E/8014392
Formula:C19 H14 Cl F N2 O3 S
MolWeight:404.848
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/8014392 |
| English Synonyms： | ZERENEX E/8014392 |
| MDL Number.： | MFCD13880025 |
| H bond acceptor： | 5 |
| H bond donor： | 3 |
| Smile： | c1ccc(c(c1)C(=O)NC(=S)Nc2ccc(c(c2)c3ccc(o3)CO)Cl)F |
| InChi： | InChI=1S/C19H14ClFN2O3S/c20-15-7-5-11(9-14(15)17-8-6-12(10-24)26-17)22-19(27)23-18(25)13-3-1-2-4-16(13)21/h1-9,24H,10H2,(H2,22,23,25,27) |
| InChiKey： | InChIKey=JNWRCZXPMUJCEF-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
