Molecular Structure:
CCD No.:CCD08259352
ZERENEX E/8014397
Formula:C20 H17 F N2 O4 S
MolWeight:400.428
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/8014397 |
| English Synonyms： | ZERENEX E/8014397 |
| MDL Number.： | MFCD13880029 |
| H bond acceptor： | 6 |
| H bond donor： | 3 |
| Smile： | COc1cc(ccc1c2ccc(o2)CO)NC(=S)NC(=O)c3ccccc3F |
| InChi： | InChI=1S/C20H17FN2O4S/c1-26-18-10-12(6-8-15(18)17-9-7-13(11-24)27-17)22-20(28)23-19(25)14-4-2-3-5-16(14)21/h2-10,24H,11H2,1H3,(H2,22,23,25,28) |
| InChiKey： | InChIKey=ZJSIZAVGCGAISN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
