Molecular Structure:
CCD No.:CCD08259791
ZERENEX E/8015099
Formula:C22 H20 N2 O6 S
MolWeight:440.474
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/8015099 |
| English Synonyms： | ZERENEX E/8015099 |
| MDL Number.： | MFCD13880468 |
| H bond acceptor： | 8 |
| H bond donor： | 3 |
| Smile： | COc1cc(ccc1c2ccc(o2)CO)NC(=S)NC(=O)c3ccc4c(c3)OCCO4 |
| InChi： | InChI=1S/C22H20N2O6S/c1-27-19-11-14(3-5-16(19)17-7-4-15(12-25)30-17)23-22(31)24-21(26)13-2-6-18-20(10-13)29-9-8-28-18/h2-7,10-11,25H,8-9,12H2,1H3,(H2,23,24,26,31) |
| InChiKey： | InChIKey=GEQIBIXFRYEMLT-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
