* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX105146 |
English Synonyms: | WUXIAPPTEC WX105146 |
MDL Number.: | MFCD14581294 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1C[C@@H]([C@]2(C1)CCCN2)c3ccccc3 |
InChi: | InChI=1S/C18H26N2O2/c1-17(2,3)22-16(21)20-12-15(14-8-5-4-6-9-14)18(13-20)10-7-11-19-18/h4-6,8-9,15,19H,7,10-13H2,1-3H3/t15-,18-/m1/s1 |
InChiKey: | InChIKey=JJNPTJKXUZDPPW-CRAIPNDOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.