Molecular Structure:
CCD No.:CCD08263377
ZERENEX E/8015078
Formula:C18 H16 N2 O5 S
MolWeight:372.399
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/8015078 |
| English Synonyms： | ZERENEX E/8015078 |
| MDL Number.： | MFCD15173221 |
| H bond acceptor： | 7 |
| H bond donor： | 3 |
| Smile： | Cc1ccc(cc1NC(=S)NC(=O)c2ccc3c(c2)OCCO3)C(=O)O |
| InChi： | InChI=1S/C18H16N2O5S/c1-10-2-3-12(17(22)23)8-13(10)19-18(26)20-16(21)11-4-5-14-15(9-11)25-7-6-24-14/h2-5,8-9H,6-7H2,1H3,(H,22,23)(H2,19,20,21,26) |
| InChiKey： | InChIKey=YJXOEXXBZQLKFP-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
