* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-OA001039 |
| English Synonyms: | ZERENEX ZX-OA001039 |
| MDL Number.: | MFCD16295315 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCn1ccnc1C(c2ccccc2)N.Cl |
| InChi: | InChI=1S/C12H15N3.ClH/c1-2-15-9-8-14-12(15)11(13)10-6-4-3-5-7-10;/h3-9,11H,2,13H2,1H3;1H |
| InChiKey: | InChIKey=LPMBDTFRZVATOP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.