* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-OA001096 |
| English Synonyms: | ZERENEX ZX-OA001096 |
| MDL Number.: | MFCD16295321 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1ccc(c(c1)CN)c2nc(cs2)C(=O)O.Cl |
| InChi: | InChI=1S/C11H10N2O2S.ClH/c12-5-7-3-1-2-4-8(7)10-13-9(6-16-10)11(14)15;/h1-4,6H,5,12H2,(H,14,15);1H |
| InChiKey: | InChIKey=UKBNDXOYTCAFPM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.