* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-OA001686 |
| English Synonyms: | ZERENEX ZX-OA001686 |
| MDL Number.: | MFCD16295343 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)c1ccc(cc1)OC(C)(C)CN.Cl |
| InChi: | InChI=1S/C14H23NO.ClH/c1-13(2,3)11-6-8-12(9-7-11)16-14(4,5)10-15;/h6-9H,10,15H2,1-5H3;1H |
| InChiKey: | InChIKey=CVYLSFFRZZOEEJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.