* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | XY-17 |
CAS: | 565438-23-5 |
English Synonyms: | XY-17 |
MDL Number.: | MFCD16628006 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](CC(F)P(=O)([O-])[O-])O.[Na+].[Na+] |
InChi: | InChI=1S/C22H42FO6P.2Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(25)29-19-20(24)18-21(23)30(26,27)28;;/h9-10,20-21,24H,2-8,11-19H2,1H3,(H2,26,27,28);;/q;2*+1/p-2/b10-9-;;/t20-,21?;;/m0../s1 |
InChiKey: | InChIKey=CTGHHDIYRPFLJU-NWSRNAPNSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.