* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XANTHORIN |
| CAS: | 17526-15-7 |
| English Synonyms: | XANTHORIN |
| MDL Number.: | MFCD16883388 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | Cc1cc2c(c(c1)O)C(=O)c3c(cc(c(c3C2=O)O)OC)O |
| InChi: | InChI=1S/C16H12O6/c1-6-3-7-11(8(17)4-6)16(21)12-9(18)5-10(22-2)15(20)13(12)14(7)19/h3-5,17-18,20H,1-2H3 |
| InChiKey: | InChIKey=GLLRIXZGBQOFLM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.