Molecular Structure:
CCD No.:CCD08267376
OTAVA-BB 1739029
Formula:C16 H16 N4 O2
MolWeight:296.328
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1739029 |
| English Synonyms： | OTAVA-BB 1739029 |
| MDL Number.： | MFCD16963543 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | Cn1ccnc1CNc2cc(nc3c2cccc3)CC(=O)O |
| InChi： | InChI=1S/C16H16N4O2/c1-20-7-6-17-15(20)10-18-14-8-11(9-16(21)22)19-13-5-3-2-4-12(13)14/h2-8H,9-10H2,1H3,(H,18,19)(H,21,22) |
| InChiKey： | InChIKey=MMGJDMGAKXXXMV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
