Molecular Structure:
CCD No.:CCD08267632
OTAVA-BB 1745503
Formula:C12 H11 N5
MolWeight:225.254
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1745503 |
| English Synonyms： | OTAVA-BB 1745503 |
| MDL Number.： | MFCD16966637 |
| H bond acceptor： | 5 |
| H bond donor： | 0 |
| Smile： | CCc1nccn1c2c3cccnc3ncn2 |
| InChi： | InChI=1S/C12H11N5/c1-2-10-13-6-7-17(10)12-9-4-3-5-14-11(9)15-8-16-12/h3-8H,2H2,1H3 |
| InChiKey： | InChIKey=UXYGNDAOFCJWIJ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
