Molecular Structure:
CCD No.:CCD08268536
OTAVA-BB 1760639
Formula:C19 H15 N3 O4 S
MolWeight:381.41
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1760639 |
| English Synonyms： | OTAVA-BB 1760639 |
| MDL Number.： | MFCD16975464 |
| H bond acceptor： | 7 |
| H bond donor： | 2 |
| Smile： | Cc1c(sc(n1)NC(=O)c2ccc3c(c2)OCO3)C(=O)Nc4ccccc4 |
| InChi： | InChI=1S/C19H15N3O4S/c1-11-16(18(24)21-13-5-3-2-4-6-13)27-19(20-11)22-17(23)12-7-8-14-15(9-12)26-10-25-14/h2-9H,10H2,1H3,(H,21,24)(H,20,22,23) |
| InChiKey： | InChIKey=QCFLCCQRZSCERM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
