Molecular Structure:
CCD No.:CCD08268604
OTAVA-BB 1761587
Formula:C17 H21 Cl N4 O2
MolWeight:348.832
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1761587 |
| English Synonyms： | OTAVA-BB 1761587 |
| MDL Number.： | MFCD16976097 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | Cn1ccnc1C(c2ccccc2Cl)NC(=O)CN3CCOCC3 |
| InChi： | InChI=1S/C17H21ClN4O2/c1-21-7-6-19-17(21)16(13-4-2-3-5-14(13)18)20-15(23)12-22-8-10-24-11-9-22/h2-7,16H,8-12H2,1H3,(H,20,23) |
| InChiKey： | InChIKey=HXDDNCOQRLZAQO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
