Molecular Structure:
CCD No.:CCD08268904
OTAVA-BB 1765441
Formula:C20 H25 N3 O3 S
MolWeight:387.501
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1765441 |
| English Synonyms： | OTAVA-BB 1765441 |
| MDL Number.： | MFCD16978567 |
| H bond acceptor： | 6 |
| H bond donor： | 0 |
| Smile： | CN(CCc1ccncc1)C(=O)C2CCN(CC2)S(=O)(=O)c3ccccc3 |
| InChi： | InChI=1S/C20H25N3O3S/c1-22(14-9-17-7-12-21-13-8-17)20(24)18-10-15-23(16-11-18)27(25,26)19-5-3-2-4-6-19/h2-8,12-13,18H,9-11,14-16H2,1H3 |
| InChiKey： | InChIKey=WSEXTDQUSOMHCT-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
