Molecular Structure:
CCD No.:CCD08268918
OTAVA-BB 1765693
Formula:C16 H22 N4 O3 S
MolWeight:350.441
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1765693 |
| English Synonyms： | OTAVA-BB 1765693 |
| MDL Number.： | MFCD16978683 |
| H bond acceptor： | 7 |
| H bond donor： | 2 |
| Smile： | Cc1c(c(n(n1)C)C)CNC(=O)C(C)NS(=O)(=O)c2ccccc2 |
| InChi： | InChI=1S/C16H22N4O3S/c1-11-15(13(3)20(4)18-11)10-17-16(21)12(2)19-24(22,23)14-8-6-5-7-9-14/h5-9,12,19H,10H2,1-4H3,(H,17,21) |
| InChiKey： | InChIKey=DDOAZOKPFIJILY-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
