Molecular Structure:
CCD No.:CCD08268980
OTAVA-BB 1766935
Formula:C14 H19 Br N2 O2 S
MolWeight:359.286
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1766935 |
| English Synonyms： | OTAVA-BB 1766935 |
| MDL Number.： | MFCD16979315 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | c1cc(ccc1S(=O)(=O)N2CCC(C2)N3CCCC3)Br |
| InChi： | InChI=1S/C14H19BrN2O2S/c15-12-3-5-14(6-4-12)20(18,19)17-10-7-13(11-17)16-8-1-2-9-16/h3-6,13H,1-2,7-11H2 |
| InChiKey： | InChIKey=CRGMYUYNXYEIFX-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
