Molecular Structure:
CCD No.:CCD08269040
OTAVA-BB 1768117
Formula:C12 H12 Cl N3 O
MolWeight:249.7
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1768117 |
| English Synonyms： | OTAVA-BB 1768117 |
| MDL Number.： | MFCD16979904 |
| H bond acceptor： | 4 |
| H bond donor： | 3 |
| Smile： | c1cc([nH]c1)CNC(=O)Nc2ccc(cc2)Cl |
| InChi： | InChI=1S/C12H12ClN3O/c13-9-3-5-10(6-4-9)16-12(17)15-8-11-2-1-7-14-11/h1-7,14H,8H2,(H2,15,16,17) |
| InChiKey： | InChIKey=GRJJLEVLFMRNOW-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
