* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX100119 |
English Synonyms: | WUXIAPPTEC WX100119 |
MDL Number.: | MFCD17016146 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C1C[C@]2(CC[C@H]1CN)CCC(=O)N2 |
InChi: | InChI=1S/C10H18N2O/c11-7-8-1-4-10(5-2-8)6-3-9(13)12-10/h8H,1-7,11H2,(H,12,13)/t8-,10- |
InChiKey: | InChIKey=QCYIGDHZNNHBST-CZMCAQCFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.