* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX120033 |
| English Synonyms: | WUXIAPPTEC WX120033 |
| MDL Number.: | MFCD17016692 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CC1(O[C@H]2C3CCC([C@H]2O1)N([C@@H]3C(=O)O)C(=O)OC(C)(C)C)C |
| InChi: | InChI=1S/C16H25NO6/c1-15(2,3)23-14(20)17-9-7-6-8(10(17)13(18)19)11-12(9)22-16(4,5)21-11/h8-12H,6-7H2,1-5H3,(H,18,19)/t8?,9?,10-,11-,12+/m0/s1 |
| InChiKey: | InChIKey=RXNYLHIKABOAKY-VJROTNAKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.