* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX125003 |
| English Synonyms: | WUXIAPPTEC WX125003 |
| MDL Number.: | MFCD17016801 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CCC2(CC1)C3CCC2C(C3)NC(=O)OCc4ccccc4 |
| InChi: | InChI=1S/C24H34N2O4/c1-23(2,3)30-22(28)26-13-11-24(12-14-26)18-9-10-19(24)20(15-18)25-21(27)29-16-17-7-5-4-6-8-17/h4-8,18-20H,9-16H2,1-3H3,(H,25,27) |
| InChiKey: | InChIKey=FYIBOPUQQLDPRW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.