* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX125025 |
| English Synonyms: | WUXIAPPTEC WX125025 |
| MDL Number.: | MFCD17016821 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)OC(=O)NC1[C@H]2CCC[C@@H]1Nc3c2cccc3 |
| InChi: | InChI=1S/C17H24N2O2/c1-17(2,3)21-16(20)19-15-12-8-6-10-14(15)18-13-9-5-4-7-11(12)13/h4-5,7,9,12,14-15,18H,6,8,10H2,1-3H3,(H,19,20)/t12-,14-,15?/m0/s1 |
| InChiKey: | InChIKey=IVRUWSXRIDJXDH-XRJCJLGXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.