* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-FLUORO-2,3,4,5-TETRAHYDRO-1H-PYRIDO[4,3-B]INDOL-1-ONE |
| CAS: | 128487-04-7 |
| English Synonyms: | 8-FLUORO-2,3,4,5-TETRAHYDRO-1H-PYRIDO[4,3-B]INDOL-1-ONE |
| MDL Number.: | MFCD23163379 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1cc2c(cc1F)c3c([nH]2)CCNC3=O |
| InChi: | InChI=1S/C11H9FN2O/c12-6-1-2-8-7(5-6)10-9(14-8)3-4-13-11(10)15/h1-2,5,14H,3-4H2,(H,13,15) |
| InChiKey: | InChIKey=MRAOJMZEBWCXOA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.