* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX101053 |
English Synonyms: | WUXIAPPTEC WX101053 |
MDL Number.: | MFCD23378273 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCC1C2(CCCN2)CCCN1C(=O)OCc3ccccc3 |
InChi: | InChI=1S/C18H26N2O2/c1-2-16-18(10-6-12-19-18)11-7-13-20(16)17(21)22-14-15-8-4-3-5-9-15/h3-5,8-9,16,19H,2,6-7,10-14H2,1H3 |
InChiKey: | InChIKey=JRDBKLGLOKKWDZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.