* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX135171 |
English Synonyms: | WUXIAPPTEC WX135171 |
MDL Number.: | MFCD23378327 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)CN2CCOC(C2)c3cc(c4ccccc4n3)Br |
InChi: | InChI=1S/C20H19BrN2O/c21-17-12-19(22-18-9-5-4-8-16(17)18)20-14-23(10-11-24-20)13-15-6-2-1-3-7-15/h1-9,12,20H,10-11,13-14H2 |
InChiKey: | InChIKey=VFXCWZWPZYLYFI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.