* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX141203 |
English Synonyms: | WUXIAPPTEC WX141203 |
MDL Number.: | MFCD23378357 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCn1cc2c(n1)C(CNC2)C(=O)OCC |
InChi: | InChI=1S/C11H17N3O2/c1-3-14-7-8-5-12-6-9(10(8)13-14)11(15)16-4-2/h7,9,12H,3-6H2,1-2H3 |
InChiKey: | InChIKey=FMYGSBHDYPJRSV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.