* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX141282 |
English Synonyms: | WUXIAPPTEC WX141282 |
MDL Number.: | MFCD23378420 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CCn1c2c(nn1)C(N(CC2)C(=O)OC(C)(C)C)CO |
InChi: | InChI=1S/C13H22N4O3/c1-5-17-9-6-7-16(12(19)20-13(2,3)4)10(8-18)11(9)14-15-17/h10,18H,5-8H2,1-4H3 |
InChiKey: | InChIKey=CNQWHQLQVUPDTQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.