* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX684057 |
English Synonyms: | WUXIAPPTEC WX684057 |
MDL Number.: | MFCD23378503 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | Cn1cc(cn1)CNN.Cl.Cl.Cl |
InChi: | InChI=1S/C5H10N4.3ClH/c1-9-4-5(2-7-6)3-8-9;;;/h3-4,7H,2,6H2,1H3;3*1H |
InChiKey: | InChIKey=QOEVJJSIIGCCHE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.