* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX690235 |
English Synonyms: | WUXIAPPTEC WX690235 |
MDL Number.: | MFCD23378511 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | C1CCOC(C1)OC[C@@H]2CCC(=O)O2 |
InChi: | InChI=1S/C10H16O4/c11-9-5-4-8(14-9)7-13-10-3-1-2-6-12-10/h8,10H,1-7H2/t8-,10?/m0/s1 |
InChiKey: | InChIKey=SMMDNCXOHGWGFR-PEHGTWAWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.