* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WXFC0109 |
English Synonyms: | WUXIAPPTEC WXFC0109 |
MDL Number.: | MFCD23378514 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C1CCC(CC1)(CN)F.Cl |
InChi: | InChI=1S/C7H14FN.ClH/c8-7(6-9)4-2-1-3-5-7;/h1-6,9H2;1H |
InChiKey: | InChIKey=XNYYXNUIHBZYFA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.