* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX111001 |
English Synonyms: | WUXIAPPTEC WX111001 |
MDL Number.: | MFCD23378528 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | COC(=O)C1CO[C@@H]2CCN(C[C@@H]2N1)C(=O)OCc3ccccc3 |
InChi: | InChI=1S/C17H22N2O5/c1-22-16(20)14-11-23-15-7-8-19(9-13(15)18-14)17(21)24-10-12-5-3-2-4-6-12/h2-6,13-15,18H,7-11H2,1H3/t13-,14?,15+/m0/s1 |
InChiKey: | InChIKey=NYLOZROPGPVNEZ-ZHDDOTHNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.