* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX603128 |
English Synonyms: | WUXIAPPTEC WX603128 |
MDL Number.: | MFCD23378553 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C[C@H](c1cnc2n1cccc2)N.Cl.Cl |
InChi: | InChI=1S/C9H11N3.2ClH/c1-7(10)8-6-11-9-4-2-3-5-12(8)9;;/h2-7H,10H2,1H3;2*1H/t7-;;/m1../s1 |
InChiKey: | InChIKey=VFHXQIUZVUXLMV-XCUBXKJBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.