Molecular Structure:
CCD No.:CCD08284547
VU 0285683
CAS No.:
327056-22-4
Formula:C14 H7 F N4 O
MolWeight:266.234
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | VU 0285683 |
| CAS： | 327056-22-4 |
| English Synonyms： | VU 0285683 |
| MDL Number.： | MFCD23381170 |
| H bond acceptor： | 5 |
| H bond donor： | 0 |
| Smile： | c1ccnc(c1)c2nc(on2)c3cc(cc(c3)F)C#N |
| InChi： | InChI=1S/C14H7FN4O/c15-11-6-9(8-16)5-10(7-11)14-18-13(19-20-14)12-3-1-2-4-17-12/h1-7H |
| InChiKey： | InChIKey=GELAFISMURFRCA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
