* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Ethyl 2-iodo-5-chloro-1,3-thiazole-4-carboxylate |
| English Synonyms: | ETHYL 2-IODO-5-CHLORO-1,3-THIAZOLE-4-CARBOXYLATE |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | IC=1SC(=C(N1)C(=O)OCC)Cl |
| InChi: | InChI=1S/C6H5ClINO2S/c1-2-11-5(10)3-4(7)12-6(8)9-3/h2H2,1H3 |
| InChiKey: | InChIKey=RRRHOJGTAGMRFT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.