* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Benzene, 1-bromo-4-[(2,2,2-trifluoroethyl)sulfonyl]- |
CAS: | 648905-23-1 |
English Synonyms: | BENZENE, 1-BROMO-4-[(2,2,2-TRIFLUOROETHYL)SULFONYL]- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC1=CC=C(C=C1)S(=O)(=O)CC(F)(F)F |
InChi: | InChI=1S/C8H6BrF3O2S/c9-6-1-3-7(4-2-6)15(13,14)5-8(10,11)12/h1-4H,5H2 |
InChiKey: | InChIKey=JPYVBAQNXPMHCF-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.