* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | tert-butyl 1H-pyrrol-2-ylcarbamate |
| English Synonyms: | TERT-BUTYL 1H-PYRROL-2-YLCARBAMATE |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | N1C(=CC=C1)NC(OC(C)(C)C)=O |
| InChi: | InChI=1S/C9H14N2O2/c1-9(2,3)13-8(12)11-7-5-4-6-10-7/h4-6,10H,1-3H3,(H,11,12) |
| InChiKey: | InChIKey=FMZRREGKVGYJDA-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.