* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde |
| CAS: | 4649-9-6 |
| English Synonyms: | 1H-PYRROLO[2,3-B]PYRIDINE-3-CARBALDEHYDE |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | N1C=C(C=2C1=NC=CC2)C=O |
| InChi: | InChI=1S/C8H6N2O/c11-5-6-4-10-8-7(6)2-1-3-9-8/h1-5H,(H,9,10) |
| InChiKey: | InChIKey=KAIWRKYDYWYFIT-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.