* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-(diisobutylamino)ethanol |
CAS: | 4535-66-4 |
English Synonyms: | 2-(DIISOBUTYLAMINO)ETHANOL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C(C)C)N(CCO)CC(C)C |
InChi: | InChI=1S/C10H23NO/c1-9(2)7-11(5-6-12)8-10(3)4/h9-10,12H,5-8H2,1-4H3 |
InChiKey: | InChIKey=UJCCSVVTAYOWLL-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.