* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SGC-707 |
| English Synonyms: | SGC 707 ; SGC-707 ; SGC707 ; 1-(ISOQUINOLIN-6-YL)-3-[2-OXO-2-(PYRROLIDIN-1-YL)ETHYL] UREA |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | C1=NC=CC2=CC(=CC=C12)NC(=O)NCC(N1CCCC1)=O |
| InChi: | InChI=1S/C16H18N4O2/c21-15(20-7-1-2-8-20)11-18-16(22)19-14-4-3-13-10-17-6-5-12(13)9-14/h3-6,9-10H,1-2,7-8,11H2,(H2,18,19,22) |
| InChiKey: | InChIKey=DMIDPTCQPIJYFE-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.