* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | BICYCLO[3.2.1]OCTANE-2,4-DIONE |
CAS: | 74896-14-3 |
English Synonyms: | BICYCLO[3.2.1]OCTANE-2,4-DIONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C12C(CC(C(CC1)C2)=O)=O |
InChi: | InChI=1S/C8H10O2/c9-7-4-8(10)6-2-1-5(7)3-6/h5-6H,1-4H2 |
InChiKey: | InChIKey=VCYHIHMHWASQAB-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.