* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1,4-Bis(7-chloroquinolin-4-yl)piperazine |
CAS: | 31502-87-1 |
English Synonyms: | 1,4-BIS(7-CHLOROQUINOLIN-4-YL)PIPERAZINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | ClC1=CC=C2C(=CC=NC2=C1)N1CCN(CC1)C1=CC=NC2=CC(=CC=C12)Cl |
InChi: | InChI=1S/C22H18Cl2N4/c23-15-1-3-17-19(13-15)25-7-5-21(17)27-9-11-28(12-10-27)22-6-8-26-20-14-16(24)2-4-18(20)22/h1-8,13-14H,9-12H2 |
InChiKey: | InChIKey=XSMHXIXQAIQGTD-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.