* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | (2S)-2-(Boc-amino)-6-heptenoic acid |
CAS: | 204711-97-7 |
English Synonyms: | (2S)-2-(BOC-AMINO)-6-HEPTENOIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OC(C)(C)C)N[C@H](C(=O)O)CCCC=C |
InChi: | InChI=1S/C12H21NO4/c1-5-6-7-8-9(10(14)15)13-11(16)17-12(2,3)4/h5,9H,1,6-8H2,2-4H3,(H,13,16)(H,14,15)/t9-/m0/s1 |
InChiKey: | InChIKey=WPKPUPUWFHDYRR-VIFPVBQESA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.