* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Threonine, N,N-dimethyl- (7CI,9CI) |
CAS: | 2812-36-4 |
English Synonyms: | THREONINE, N,N-DIMETHYL- (7CI,9CI) |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CN([C@@H]([C@H](O)C)C(=O)O)C |
InChi: | InChI=1S/C6H13NO3/c1-4(8)5(6(9)10)7(2)3/h4-5,8H,1-3H3,(H,9,10)/t4-,5+/m1/s1 |
InChiKey: | InChIKey=CIVVRPHZRYVSCF-UHNVWZDZSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.