* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzeneacetic acid, 2,3,4,5,6-pentafluoro-α-oxo- |
CAS: | 72331-54-5 |
English Synonyms: | BENZENEACETIC ACID, 2,3,4,5,6-PENTAFLUORO-Α-OXO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | FC1=C(C(=C(C(=C1F)F)F)F)C(C(=O)O)=O |
InChi: | InChI=1S/C8HF5O3/c9-2-1(7(14)8(15)16)3(10)5(12)6(13)4(2)11/h(H,15,16) |
InChiKey: | InChIKey=LSBXSIGZDLYSIY-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.